C28H33F2N3O4 — CID 169163663
(E)-1-[4-(3-cyclopropyl-1-benzofuran-2-yl)-1,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl]-4,4-difluoro-2-(3-hydroxybut-1-en-2-yloxy)-3-methylbut-2-en-1-one;ethane (PubChem CID 169163663) has the molecular formula C28H33F2N3O4 and a molecular weight of 513.59 g/mol. Its IUPAC name is (E)-1-[4-(3-cyclopropyl-1-benzofuran-2-yl)-1,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl]-4,4-difluoro-2-(3-hydroxybut-1-en-2-yloxy)-3-methylbut-2-en-1-one;ethane.
| Compound Name | (E)-1-[4-(3-cyclopropyl-1-benzofuran-2-yl)-1,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl]-4,4-difluoro-2-(3-hydroxybut-1-en-2-yloxy)-3-methylbut-2-en-1-one;ethane |
|---|---|
| PubChem CID | 169163663 |
| Molecular Formula | C28H33F2N3O4 |
| Molecular Weight | 513.59 g/mol |
| Exact Mass | 513.24 |
| IUPAC Name | (E)-1-[4-(3-cyclopropyl-1-benzofuran-2-yl)-1,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl]-4,4-difluoro-2-(3-hydroxybut-1-en-2-yloxy)-3-methylbut-2-en-1-one;ethane |
| SMILES | C=C(O/C(C(=O)N1CCc2[nH]cnc2C1c1oc2ccccc2c1C1CC1)=C(\C)C(F)F)C(C)O.CC |
| InChI | InChI=1S/C26H27F2N3O4.C2H6/c1-13(25(27)28)23(34-15(3)14(2)32)26(33)31-11-10-18-21(30-12-29-18)22(31)24-20(16-8-9-16)17-6-4-5-7-19(17)35-24;1-2/h4-7,12,14,16,22,25,32H,3,8-11H2,1-2H3,(H,29,30);1-2H3/b23-13+; |
| InChIKey | JYXCMUZQJFYVLT-PUZWSPMBSA-N |
| XLogP | 5.98 |
| TPSA | 91.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.59 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|