C30H33FN4O3 — CID 169163305
2-[(4E,6Z)-4-ethyl-2-methylnona-2,4,6,8-tetraen-3-yl]oxy-1-[(4S)-4-(7-fluoro-1,3-benzoxazol-2-yl)-1,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl]-3-methylbut-2-en-1-one (PubChem CID 169163305) has the molecular formula C30H33FN4O3 and a molecular weight of 516.62 g/mol. Its IUPAC name is 2-[(4E,6Z)-4-ethyl-2-methylnona-2,4,6,8-tetraen-3-yl]oxy-1-[(4S)-4-(7-fluoro-1,3-benzoxazol-2-yl)-1,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl]-3-methylbut-2-en-1-one.
| Compound Name | 2-[(4E,6Z)-4-ethyl-2-methylnona-2,4,6,8-tetraen-3-yl]oxy-1-[(4S)-4-(7-fluoro-1,3-benzoxazol-2-yl)-1,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl]-3-methylbut-2-en-1-one |
|---|---|
| PubChem CID | 169163305 |
| Molecular Formula | C30H33FN4O3 |
| Molecular Weight | 516.62 g/mol |
| Exact Mass | 516.25 |
| IUPAC Name | 2-[(4E,6Z)-4-ethyl-2-methylnona-2,4,6,8-tetraen-3-yl]oxy-1-[(4S)-4-(7-fluoro-1,3-benzoxazol-2-yl)-1,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl]-3-methylbut-2-en-1-one |
| SMILES | C=C/C=C\C=C(/CC)C(OC(C(=O)N1CCc2[nH]cnc2[C@H]1c1nc2cccc(F)c2o1)=C(C)C)=C(C)C |
| InChI | InChI=1S/C30H33FN4O3/c1-7-9-10-12-20(8-2)26(18(3)4)37-27(19(5)6)30(36)35-16-15-22-24(33-17-32-22)25(35)29-34-23-14-11-13-21(31)28(23)38-29/h7,9-14,17,25H,1,8,15-16H2,2-6H3,(H,32,33)/b10-9-,20-12+/t25-/m0/s1 |
| InChIKey | ZHRNISFUQKUGCJ-OLSFTZLQSA-N |
| XLogP | 6.85 |
| TPSA | 84.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.62 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|