C18H13F4N7O2 — CID 176763500
[(4S)-4-(7-fluoro-1,3-benzoxazol-2-yl)-3,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl]-[2-methyl-5-(trifluoromethyl)-1,2,4-triazol-3-yl]methanone (PubChem CID 176763500) has the molecular formula C18H13F4N7O2 and a molecular weight of 435.34 g/mol. Its IUPAC name is [(4S)-4-(7-fluoro-1,3-benzoxazol-2-yl)-3,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl]-[2-methyl-5-(trifluoromethyl)-1,2,4-triazol-3-yl]methanone.
| Compound Name | [(4S)-4-(7-fluoro-1,3-benzoxazol-2-yl)-3,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl]-[2-methyl-5-(trifluoromethyl)-1,2,4-triazol-3-yl]methanone |
|---|---|
| PubChem CID | 176763500 |
| Molecular Formula | C18H13F4N7O2 |
| Molecular Weight | 435.34 g/mol |
| Exact Mass | 435.11 |
| IUPAC Name | [(4S)-4-(7-fluoro-1,3-benzoxazol-2-yl)-3,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl]-[2-methyl-5-(trifluoromethyl)-1,2,4-triazol-3-yl]methanone |
| SMILES | Cn1nc(C(F)(F)F)nc1C(=O)N1CCc2nc[nH]c2[C@H]1c1nc2cccc(F)c2o1 |
| InChI | InChI=1S/C18H13F4N7O2/c1-28-14(26-17(27-28)18(20,21)22)16(30)29-6-5-9-11(24-7-23-9)12(29)15-25-10-4-2-3-8(19)13(10)31-15/h2-4,7,12H,5-6H2,1H3,(H,23,24)/t12-/m0/s1 |
| InChIKey | PMNMKJFUSKITCG-LBPRGKRZSA-N |
| XLogP | 2.63 |
| TPSA | 105.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.34 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |