C22H24N4O3 — CID 169167925
6-amino-1-benzyl-5-[2-(benzylamino)acetyl]-3-ethylpyrimidine-2,4-dione (PubChem CID 169167925) has the molecular formula C22H24N4O3 and a molecular weight of 392.46 g/mol. Its IUPAC name is 6-amino-1-benzyl-5-[2-(benzylamino)acetyl]-3-ethylpyrimidine-2,4-dione.
| Compound Name | 6-amino-1-benzyl-5-[2-(benzylamino)acetyl]-3-ethylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 169167925 |
| Molecular Formula | C22H24N4O3 |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | 6-amino-1-benzyl-5-[2-(benzylamino)acetyl]-3-ethylpyrimidine-2,4-dione |
| SMILES | CCn1c(=O)c(C(=O)CNCc2ccccc2)c(N)n(Cc2ccccc2)c1=O |
| InChI | InChI=1S/C22H24N4O3/c1-2-25-21(28)19(18(27)14-24-13-16-9-5-3-6-10-16)20(23)26(22(25)29)15-17-11-7-4-8-12-17/h3-12,24H,2,13-15,23H2,1H3 |
| InChIKey | WVJFLQFUSXXSLT-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 99.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |