C22H23N3O3S — CID 8549023
6-amino-1-benzyl-5-(2-benzylsulfanylacetyl)-3-ethylpyrimidine-2,4-dione (PubChem CID 8549023) has the molecular formula C22H23N3O3S and a molecular weight of 409.51 g/mol. Its IUPAC name is 6-amino-1-benzyl-5-(2-benzylsulfanylacetyl)-3-ethylpyrimidine-2,4-dione.
| Compound Name | 6-amino-1-benzyl-5-(2-benzylsulfanylacetyl)-3-ethylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 8549023 |
| Molecular Formula | C22H23N3O3S |
| Molecular Weight | 409.51 g/mol |
| Exact Mass | 409.15 |
| IUPAC Name | 6-amino-1-benzyl-5-(2-benzylsulfanylacetyl)-3-ethylpyrimidine-2,4-dione |
| SMILES | CCn1c(=O)c(C(=O)CSCc2ccccc2)c(N)n(Cc2ccccc2)c1=O |
| InChI | InChI=1S/C22H23N3O3S/c1-2-24-21(27)19(18(26)15-29-14-17-11-7-4-8-12-17)20(23)25(22(24)28)13-16-9-5-3-6-10-16/h3-12H,2,13-15,23H2,1H3 |
| InChIKey | KBQNHDOELYGNHV-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 87.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.51 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |