C23H34F2N6 — CID 169170357
(Z)-N'-(5-cyclopentyl-1H-pyrazol-3-yl)-N-[1-[(5,5-difluoro-2-methyl-2-azaspiro[3.5]nonan-7-yl)amino]ethenyl]but-2-enimidamide (PubChem CID 169170357) has the molecular formula C23H34F2N6 and a molecular weight of 432.56 g/mol. Its IUPAC name is (Z)-N'-(5-cyclopentyl-1H-pyrazol-3-yl)-N-[1-[(5,5-difluoro-2-methyl-2-azaspiro[3.5]nonan-7-yl)amino]ethenyl]but-2-enimidamide.
| Compound Name | (Z)-N'-(5-cyclopentyl-1H-pyrazol-3-yl)-N-[1-[(5,5-difluoro-2-methyl-2-azaspiro[3.5]nonan-7-yl)amino]ethenyl]but-2-enimidamide |
|---|---|
| PubChem CID | 169170357 |
| Molecular Formula | C23H34F2N6 |
| Molecular Weight | 432.56 g/mol |
| Exact Mass | 432.28 |
| IUPAC Name | (Z)-N'-(5-cyclopentyl-1H-pyrazol-3-yl)-N-[1-[(5,5-difluoro-2-methyl-2-azaspiro[3.5]nonan-7-yl)amino]ethenyl]but-2-enimidamide |
| SMILES | C=C(NC(/C=C\C)=N/c1cc(C2CCCC2)[nH]n1)NC1CCC2(CN(C)C2)C(F)(F)C1 |
| InChI | InChI=1S/C23H34F2N6/c1-4-7-20(28-21-12-19(29-30-21)17-8-5-6-9-17)27-16(2)26-18-10-11-22(14-31(3)15-22)23(24,25)13-18/h4,7,12,17-18,26H,2,5-6,8-11,13-15H2,1,3H3,(H2,27,28,29,30)/b7-4- |
| InChIKey | YGQRHSJRBVLYJE-DAXSKMNVSA-N |
| XLogP | 4.44 |
| TPSA | 68.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.56 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|