C21H24ClN5O4S — CID 169171719
ethanimidoyl (4S)-6-amino-4-[[(2S)-1-[1-(5-chlorothiophen-2-yl)cyclopropanecarbonyl]pyrrolidine-2-carbonyl]amino]-6-oxohex-2-ynimidate (PubChem CID 169171719) has the molecular formula C21H24ClN5O4S and a molecular weight of 477.97 g/mol. Its IUPAC name is ethanimidoyl (4S)-6-amino-4-[[(2S)-1-[1-(5-chlorothiophen-2-yl)cyclopropanecarbonyl]pyrrolidine-2-carbonyl]amino]-6-oxohex-2-ynimidate.
| Compound Name | ethanimidoyl (4S)-6-amino-4-[[(2S)-1-[1-(5-chlorothiophen-2-yl)cyclopropanecarbonyl]pyrrolidine-2-carbonyl]amino]-6-oxohex-2-ynimidate |
|---|---|
| PubChem CID | 169171719 |
| Molecular Formula | C21H24ClN5O4S |
| Molecular Weight | 477.97 g/mol |
| Exact Mass | 477.12 |
| IUPAC Name | ethanimidoyl (4S)-6-amino-4-[[(2S)-1-[1-(5-chlorothiophen-2-yl)cyclopropanecarbonyl]pyrrolidine-2-carbonyl]amino]-6-oxohex-2-ynimidate |
| SMILES | [H]/N=C(/C#C[C@H](CC(N)=O)NC(=O)[C@@H]1CCCN1C(=O)C1(c2ccc(Cl)s2)CC1)O/C(C)=N/[H] |
| InChI | InChI=1S/C21H24ClN5O4S/c1-12(23)31-18(25)7-4-13(11-17(24)28)26-19(29)14-3-2-10-27(14)20(30)21(8-9-21)15-5-6-16(22)32-15/h5-6,13-14,23,25H,2-3,8-11H2,1H3,(H2,24,28)(H,26,29)/b23-12+,25-18-/t13-,14+/m1/s1 |
| InChIKey | UFKRXOXLHKNLFP-NIJGSFBNSA-N |
| XLogP | 1.78 |
| TPSA | 149.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.97 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|