C20H21ClF4N4O5 — CID 171478495
2-[[(2R)-2-chloro-2-fluoroacetyl]-[[(2S)-1-[1-[4-(trifluoromethoxy)phenyl]cyclopropanecarbonyl]pyrrolidine-2-carbonyl]amino]amino]acetamide (PubChem CID 171478495) has the molecular formula C20H21ClF4N4O5 and a molecular weight of 508.86 g/mol. Its IUPAC name is 2-[[(2R)-2-chloro-2-fluoroacetyl]-[[(2S)-1-[1-[4-(trifluoromethoxy)phenyl]cyclopropanecarbonyl]pyrrolidine-2-carbonyl]amino]amino]acetamide.
| Compound Name | 2-[[(2R)-2-chloro-2-fluoroacetyl]-[[(2S)-1-[1-[4-(trifluoromethoxy)phenyl]cyclopropanecarbonyl]pyrrolidine-2-carbonyl]amino]amino]acetamide |
|---|---|
| PubChem CID | 171478495 |
| Molecular Formula | C20H21ClF4N4O5 |
| Molecular Weight | 508.86 g/mol |
| Exact Mass | 508.11 |
| IUPAC Name | 2-[[(2R)-2-chloro-2-fluoroacetyl]-[[(2S)-1-[1-[4-(trifluoromethoxy)phenyl]cyclopropanecarbonyl]pyrrolidine-2-carbonyl]amino]amino]acetamide |
| SMILES | NC(=O)CN(NC(=O)[C@@H]1CCCN1C(=O)C1(c2ccc(OC(F)(F)F)cc2)CC1)C(=O)[C@H](F)Cl |
| InChI | InChI=1S/C20H21ClF4N4O5/c21-15(22)17(32)29(10-14(26)30)27-16(31)13-2-1-9-28(13)18(33)19(7-8-19)11-3-5-12(6-4-11)34-20(23,24)25/h3-6,13,15H,1-2,7-10H2,(H2,26,30)(H,27,31)/t13-,15-/m0/s1 |
| InChIKey | QNUQMADSFHPCMU-ZFWWWQNUSA-N |
| XLogP | 1.49 |
| TPSA | 122.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.86 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|