C23H24F3N3O5 — CID 169171795
(2S)-N-[(E)-5-amino-5-oxopent-3-en-1-yn-3-yl]-1-[3-methoxy-1-[4-(trifluoromethoxy)phenyl]cyclobutanecarbonyl]pyrrolidine-2-carboxamide (PubChem CID 169171795) has the molecular formula C23H24F3N3O5 and a molecular weight of 479.46 g/mol. Its IUPAC name is (2S)-N-[(E)-5-amino-5-oxopent-3-en-1-yn-3-yl]-1-[3-methoxy-1-[4-(trifluoromethoxy)phenyl]cyclobutanecarbonyl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-N-[(E)-5-amino-5-oxopent-3-en-1-yn-3-yl]-1-[3-methoxy-1-[4-(trifluoromethoxy)phenyl]cyclobutanecarbonyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 169171795 |
| Molecular Formula | C23H24F3N3O5 |
| Molecular Weight | 479.46 g/mol |
| Exact Mass | 479.17 |
| IUPAC Name | (2S)-N-[(E)-5-amino-5-oxopent-3-en-1-yn-3-yl]-1-[3-methoxy-1-[4-(trifluoromethoxy)phenyl]cyclobutanecarbonyl]pyrrolidine-2-carboxamide |
| SMILES | C#C/C(=C\C(N)=O)NC(=O)[C@@H]1CCCN1C(=O)C1(c2ccc(OC(F)(F)F)cc2)CC(OC)C1 |
| InChI | InChI=1S/C23H24F3N3O5/c1-3-15(11-19(27)30)28-20(31)18-5-4-10-29(18)21(32)22(12-17(13-22)33-2)14-6-8-16(9-7-14)34-23(24,25)26/h1,6-9,11,17-18H,4-5,10,12-13H2,2H3,(H2,27,30)(H,28,31)/b15-11+/t17?,18-,22?/m0/s1 |
| InChIKey | LBQNGVJBGBVUHU-SADKVLDTSA-N |
| XLogP | 1.74 |
| TPSA | 110.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.46 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|