About 3-[(8,8-dimethyl-1-oxaspiro[4.5]decan-2-yl)oxy]-2,2-dimethylpropan-1-ol
3-[(8,8-dimethyl-1-oxaspiro[4.5]decan-2-yl)oxy]-2,2-dimethylpropan-1-ol (PubChem CID 169171978) has the molecular formula C16H30O3
and a molecular weight of 270.41 g/mol. Its IUPAC name is 3-[(8,8-dimethyl-1-oxaspiro[4.5]decan-2-yl)oxy]-2,2-dimethylpropan-1-ol.
Molecular Properties
| Compound Name | 3-[(8,8-dimethyl-1-oxaspiro[4.5]decan-2-yl)oxy]-2,2-dimethylpropan-1-ol |
| PubChem CID | 169171978 |
| Molecular Formula | C16H30O3 |
| Molecular Weight | 270.41 g/mol |
| Exact Mass | 270.22 |
| IUPAC Name | 3-[(8,8-dimethyl-1-oxaspiro[4.5]decan-2-yl)oxy]-2,2-dimethylpropan-1-ol |
| SMILES | CC1(C)CCC2(CCC(OCC(C)(C)CO)O2)CC1 |
| InChI | InChI=1S/C16H30O3/c1-14(2)7-9-16(10-8-14)6-5-13(19-16)18-12-15(3,4)11-17/h13,17H,5-12H2,1-4H3 |
| InChIKey | ODBIVQOYGOWAGZ-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.41 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[(8,8-dimethyl-1-oxaspiro[4.5]decan-2-yl)oxy]-2,2-dimethylpropan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(8,8-dimethyl-1-oxaspiro[4.5]decan-2-yl)oxy]-2,2-dimethylpropan-1-ol?
The IUPAC name of 3-[(8,8-dimethyl-1-oxaspiro[4.5]decan-2-yl)oxy]-2,2-dimethylpropan-1-ol (CID 169171978) is 3-[(8,8-dimethyl-1-oxaspiro[4.5]decan-2-yl)oxy]-2,2-dimethylpropan-1-ol.
What is the SMILES notation for 3-[(8,8-dimethyl-1-oxaspiro[4.5]decan-2-yl)oxy]-2,2-dimethylpropan-1-ol?
The canonical SMILES for 3-[(8,8-dimethyl-1-oxaspiro[4.5]decan-2-yl)oxy]-2,2-dimethylpropan-1-ol is CC1(C)CCC2(CCC(OCC(C)(C)CO)O2)CC1.
What is the InChIKey of 3-[(8,8-dimethyl-1-oxaspiro[4.5]decan-2-yl)oxy]-2,2-dimethylpropan-1-ol?
The InChIKey is ODBIVQOYGOWAGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H30O3/c1-14(2)7-9-16(10-8-14)6-5-13(19-16)18-12-15(3,4)11-17/h13,17H,5-12H2,1-4H3.
What are the key properties of 3-[(8,8-dimethyl-1-oxaspiro[4.5]decan-2-yl)oxy]-2,2-dimethylpropan-1-ol?
3-[(8,8-dimethyl-1-oxaspiro[4.5]decan-2-yl)oxy]-2,2-dimethylpropan-1-ol has a molecular weight of 270.41 g/mol, XLogP of 3.50, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(8,8-dimethyl-1-oxaspiro[4.5]decan-2-yl)oxy]-2,2-dimethylpropan-1-ol is sourced from PubChem (CID 169171978), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).