C15H28O3 — CID 169171995
2-[[(2S)-8-tert-butyl-1-oxaspiro[4.5]decan-2-yl]oxy]ethanol (PubChem CID 169171995) has the molecular formula C15H28O3 and a molecular weight of 256.39 g/mol. Its IUPAC name is 2-[[(2S)-8-tert-butyl-1-oxaspiro[4.5]decan-2-yl]oxy]ethanol.
| Compound Name | 2-[[(2S)-8-tert-butyl-1-oxaspiro[4.5]decan-2-yl]oxy]ethanol |
|---|---|
| PubChem CID | 169171995 |
| Molecular Formula | C15H28O3 |
| Molecular Weight | 256.39 g/mol |
| Exact Mass | 256.20 |
| IUPAC Name | 2-[[(2S)-8-tert-butyl-1-oxaspiro[4.5]decan-2-yl]oxy]ethanol |
| SMILES | CC(C)(C)C1CCC2(CC1)CC[C@@H](OCCO)O2 |
| InChI | InChI=1S/C15H28O3/c1-14(2,3)12-4-7-15(8-5-12)9-6-13(18-15)17-11-10-16/h12-13,16H,4-11H2,1-3H3/t12?,13-,15?/m0/s1 |
| InChIKey | VWHOTHSODKTSLH-OWYJLGKBSA-N |
| XLogP | 3.11 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.39 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |