About 2-[(8,8-dimethyl-1-oxaspiro[4.5]decan-2-yl)oxy]cyclohexan-1-ol
2-[(8,8-dimethyl-1-oxaspiro[4.5]decan-2-yl)oxy]cyclohexan-1-ol (PubChem CID 169171951) has the molecular formula C17H30O3
and a molecular weight of 282.42 g/mol. Its IUPAC name is 2-[(8,8-dimethyl-1-oxaspiro[4.5]decan-2-yl)oxy]cyclohexan-1-ol.
Molecular Properties
| Compound Name | 2-[(8,8-dimethyl-1-oxaspiro[4.5]decan-2-yl)oxy]cyclohexan-1-ol |
| PubChem CID | 169171951 |
| Molecular Formula | C17H30O3 |
| Molecular Weight | 282.42 g/mol |
| Exact Mass | 282.22 |
| IUPAC Name | 2-[(8,8-dimethyl-1-oxaspiro[4.5]decan-2-yl)oxy]cyclohexan-1-ol |
| SMILES | CC1(C)CCC2(CCC(OC3CCCCC3O)O2)CC1 |
| InChI | InChI=1S/C17H30O3/c1-16(2)9-11-17(12-10-16)8-7-15(20-17)19-14-6-4-3-5-13(14)18/h13-15,18H,3-12H2,1-2H3 |
| InChIKey | CTVZMYGKIKYVMT-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.42 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[(8,8-dimethyl-1-oxaspiro[4.5]decan-2-yl)oxy]cyclohexan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(8,8-dimethyl-1-oxaspiro[4.5]decan-2-yl)oxy]cyclohexan-1-ol?
The IUPAC name of 2-[(8,8-dimethyl-1-oxaspiro[4.5]decan-2-yl)oxy]cyclohexan-1-ol (CID 169171951) is 2-[(8,8-dimethyl-1-oxaspiro[4.5]decan-2-yl)oxy]cyclohexan-1-ol.
What is the SMILES notation for 2-[(8,8-dimethyl-1-oxaspiro[4.5]decan-2-yl)oxy]cyclohexan-1-ol?
The canonical SMILES for 2-[(8,8-dimethyl-1-oxaspiro[4.5]decan-2-yl)oxy]cyclohexan-1-ol is CC1(C)CCC2(CCC(OC3CCCCC3O)O2)CC1.
What is the InChIKey of 2-[(8,8-dimethyl-1-oxaspiro[4.5]decan-2-yl)oxy]cyclohexan-1-ol?
The InChIKey is CTVZMYGKIKYVMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H30O3/c1-16(2)9-11-17(12-10-16)8-7-15(20-17)19-14-6-4-3-5-13(14)18/h13-15,18H,3-12H2,1-2H3.
What are the key properties of 2-[(8,8-dimethyl-1-oxaspiro[4.5]decan-2-yl)oxy]cyclohexan-1-ol?
2-[(8,8-dimethyl-1-oxaspiro[4.5]decan-2-yl)oxy]cyclohexan-1-ol has a molecular weight of 282.42 g/mol, XLogP of 3.78, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(8,8-dimethyl-1-oxaspiro[4.5]decan-2-yl)oxy]cyclohexan-1-ol is sourced from PubChem (CID 169171951), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).