C18H31NO — CID 169173047
4-[(2Z,4E,6E)-octa-2,4,6-trien-4-yl]oxy-1-pentan-2-ylpiperidine (PubChem CID 169173047) has the molecular formula C18H31NO and a molecular weight of 277.45 g/mol. Its IUPAC name is 4-[(2Z,4E,6E)-octa-2,4,6-trien-4-yl]oxy-1-pentan-2-ylpiperidine.
| Compound Name | 4-[(2Z,4E,6E)-octa-2,4,6-trien-4-yl]oxy-1-pentan-2-ylpiperidine |
|---|---|
| PubChem CID | 169173047 |
| Molecular Formula | C18H31NO |
| Molecular Weight | 277.45 g/mol |
| Exact Mass | 277.24 |
| IUPAC Name | 4-[(2Z,4E,6E)-octa-2,4,6-trien-4-yl]oxy-1-pentan-2-ylpiperidine |
| SMILES | C/C=C\C(=C/C=C/C)OC1CCN(C(C)CCC)CC1 |
| InChI | InChI=1S/C18H31NO/c1-5-8-11-17(10-7-3)20-18-12-14-19(15-13-18)16(4)9-6-2/h5,7-8,10-11,16,18H,6,9,12-15H2,1-4H3/b8-5+,10-7-,17-11+ |
| InChIKey | CDZHDULZGOJBGW-DBNHGZKNSA-N |
| XLogP | 4.69 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.45 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|