C17H12N4O2S — CID 16917410
N-(5-benzyl-1,3,4-oxadiazol-2-yl)-1,3-benzothiazole-6-carboxamide (PubChem CID 16917410) has the molecular formula C17H12N4O2S and a molecular weight of 336.38 g/mol. Its IUPAC name is N-(5-benzyl-1,3,4-oxadiazol-2-yl)-1,3-benzothiazole-6-carboxamide.
| Compound Name | N-(5-benzyl-1,3,4-oxadiazol-2-yl)-1,3-benzothiazole-6-carboxamide |
|---|---|
| PubChem CID | 16917410 |
| Molecular Formula | C17H12N4O2S |
| Molecular Weight | 336.38 g/mol |
| Exact Mass | 336.07 |
| IUPAC Name | N-(5-benzyl-1,3,4-oxadiazol-2-yl)-1,3-benzothiazole-6-carboxamide |
| SMILES | O=C(Nc1nnc(Cc2ccccc2)o1)c1ccc2ncsc2c1 |
| InChI | InChI=1S/C17H12N4O2S/c22-16(12-6-7-13-14(9-12)24-10-18-13)19-17-21-20-15(23-17)8-11-4-2-1-3-5-11/h1-7,9-10H,8H2,(H,19,21,22) |
| InChIKey | ZXHYKXAJGKPYPB-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 80.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.38 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |