C33H27ClN6O2 — CID 169175170
4-[2-[[4-[2-(2-amino-3-pyridinyl)-5-phenylimidazo[4,5-b]pyridin-3-yl]phenyl]methylamino]ethyl]-3-chloro-2-hydroxybenzaldehyde (PubChem CID 169175170) has the molecular formula C33H27ClN6O2 and a molecular weight of 575.07 g/mol. Its IUPAC name is 4-[2-[[4-[2-(2-amino-3-pyridinyl)-5-phenylimidazo[4,5-b]pyridin-3-yl]phenyl]methylamino]ethyl]-3-chloro-2-hydroxybenzaldehyde.
| Compound Name | 4-[2-[[4-[2-(2-amino-3-pyridinyl)-5-phenylimidazo[4,5-b]pyridin-3-yl]phenyl]methylamino]ethyl]-3-chloro-2-hydroxybenzaldehyde |
|---|---|
| PubChem CID | 169175170 |
| Molecular Formula | C33H27ClN6O2 |
| Molecular Weight | 575.07 g/mol |
| Exact Mass | 574.19 |
| IUPAC Name | 4-[2-[[4-[2-(2-amino-3-pyridinyl)-5-phenylimidazo[4,5-b]pyridin-3-yl]phenyl]methylamino]ethyl]-3-chloro-2-hydroxybenzaldehyde |
| SMILES | Nc1ncccc1-c1nc2ccc(-c3ccccc3)nc2n1-c1ccc(CNCCc2ccc(C=O)c(O)c2Cl)cc1 |
| InChI | InChI=1S/C33H27ClN6O2/c34-29-23(10-11-24(20-41)30(29)42)16-18-36-19-21-8-12-25(13-9-21)40-32(26-7-4-17-37-31(26)35)39-28-15-14-27(38-33(28)40)22-5-2-1-3-6-22/h1-15,17,20,36,42H,16,18-19H2,(H2,35,37) |
| InChIKey | PAQXKBMXICLXMI-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 118.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.07 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|