C28H29N7 — CID 171563268
N'-[[4-[2-(2-amino-3-pyridinyl)-5-phenylimidazo[4,5-b]pyridin-3-yl]phenyl]methyl]butane-1,4-diamine (PubChem CID 171563268) has the molecular formula C28H29N7 and a molecular weight of 463.59 g/mol. Its IUPAC name is N'-[[4-[2-(2-amino-3-pyridinyl)-5-phenylimidazo[4,5-b]pyridin-3-yl]phenyl]methyl]butane-1,4-diamine.
| Compound Name | N'-[[4-[2-(2-amino-3-pyridinyl)-5-phenylimidazo[4,5-b]pyridin-3-yl]phenyl]methyl]butane-1,4-diamine |
|---|---|
| PubChem CID | 171563268 |
| Molecular Formula | C28H29N7 |
| Molecular Weight | 463.59 g/mol |
| Exact Mass | 463.25 |
| IUPAC Name | N'-[[4-[2-(2-amino-3-pyridinyl)-5-phenylimidazo[4,5-b]pyridin-3-yl]phenyl]methyl]butane-1,4-diamine |
| SMILES | NCCCCNCc1ccc(-n2c(-c3cccnc3N)nc3ccc(-c4ccccc4)nc32)cc1 |
| InChI | InChI=1S/C28H29N7/c29-16-4-5-17-31-19-20-10-12-22(13-11-20)35-27(23-9-6-18-32-26(23)30)34-25-15-14-24(33-28(25)35)21-7-2-1-3-8-21/h1-3,6-15,18,31H,4-5,16-17,19,29H2,(H2,30,32) |
| InChIKey | JZRAAPQZYIVCEH-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 107.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.59 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|