C29H31BN7 — CID 171494660
CID 171494660 (PubChem CID 171494660) has the molecular formula C29H31BN7 and a molecular weight of 488.43 g/mol.
| Compound Name | CID 171494660 |
|---|---|
| PubChem CID | 171494660 |
| Molecular Formula | C29H31BN7 |
| Molecular Weight | 488.43 g/mol |
| Exact Mass | 488.27 |
| IUPAC Name | — |
| SMILES | CC.Nc1ncccc1-c1nc2ccc(-c3ccccc3)nc2n1-c1ccc(CNCC2[B]CN2)cc1 |
| InChI | InChI=1S/C27H25BN7.C2H6/c29-25-21(7-4-14-31-25)26-34-23-13-12-22(19-5-2-1-3-6-19)33-27(23)35(26)20-10-8-18(9-11-20)15-30-16-24-28-17-32-24;1-2/h1-14,24,30,32H,15-17H2,(H2,29,31);1-2H3 |
| InChIKey | ACCZIVUYGCKKDE-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 93.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.43 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|