C19H21N3O — CID 169175933
2,5-dimethyl-N-(4-methyl-3-pyridazin-3-ylphenyl)cyclopent-3-ene-1-carboxamide (PubChem CID 169175933) has the molecular formula C19H21N3O and a molecular weight of 307.40 g/mol. Its IUPAC name is 2,5-dimethyl-N-(4-methyl-3-pyridazin-3-ylphenyl)cyclopent-3-ene-1-carboxamide.
| Compound Name | 2,5-dimethyl-N-(4-methyl-3-pyridazin-3-ylphenyl)cyclopent-3-ene-1-carboxamide |
|---|---|
| PubChem CID | 169175933 |
| Molecular Formula | C19H21N3O |
| Molecular Weight | 307.40 g/mol |
| Exact Mass | 307.17 |
| IUPAC Name | 2,5-dimethyl-N-(4-methyl-3-pyridazin-3-ylphenyl)cyclopent-3-ene-1-carboxamide |
| SMILES | Cc1ccc(NC(=O)C2C(C)C=CC2C)cc1-c1cccnn1 |
| InChI | InChI=1S/C19H21N3O/c1-12-8-9-15(11-16(12)17-5-4-10-20-22-17)21-19(23)18-13(2)6-7-14(18)3/h4-11,13-14,18H,1-3H3,(H,21,23) |
| InChIKey | SPYSFZSRYONJNO-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.40 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|