C20H20N4O — CID 169176130
N-[3-(6-cyano-2-pyridinyl)-4-methylphenyl]-6-azabicyclo[3.1.1]heptane-6-carboxamide (PubChem CID 169176130) has the molecular formula C20H20N4O and a molecular weight of 332.41 g/mol. Its IUPAC name is N-[3-(6-cyano-2-pyridinyl)-4-methylphenyl]-6-azabicyclo[3.1.1]heptane-6-carboxamide.
| Compound Name | N-[3-(6-cyano-2-pyridinyl)-4-methylphenyl]-6-azabicyclo[3.1.1]heptane-6-carboxamide |
|---|---|
| PubChem CID | 169176130 |
| Molecular Formula | C20H20N4O |
| Molecular Weight | 332.41 g/mol |
| Exact Mass | 332.16 |
| IUPAC Name | N-[3-(6-cyano-2-pyridinyl)-4-methylphenyl]-6-azabicyclo[3.1.1]heptane-6-carboxamide |
| SMILES | Cc1ccc(NC(=O)N2C3CCCC2C3)cc1-c1cccc(C#N)n1 |
| InChI | InChI=1S/C20H20N4O/c1-13-8-9-14(10-18(13)19-7-2-4-15(12-21)22-19)23-20(25)24-16-5-3-6-17(24)11-16/h2,4,7-10,16-17H,3,5-6,11H2,1H3,(H,23,25) |
| InChIKey | OMMSVFBDEVTMPR-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 69.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.41 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |