C11H17N3O — CID 169179771
3-[[3-[(E)-but-2-en-2-yl]oxetan-3-yl]methyl]-4-methyl-1,2,4-triazole (PubChem CID 169179771) has the molecular formula C11H17N3O and a molecular weight of 207.28 g/mol. Its IUPAC name is 3-[[3-[(E)-but-2-en-2-yl]oxetan-3-yl]methyl]-4-methyl-1,2,4-triazole.
| Compound Name | 3-[[3-[(E)-but-2-en-2-yl]oxetan-3-yl]methyl]-4-methyl-1,2,4-triazole |
|---|---|
| PubChem CID | 169179771 |
| Molecular Formula | C11H17N3O |
| Molecular Weight | 207.28 g/mol |
| Exact Mass | 207.14 |
| IUPAC Name | 3-[[3-[(E)-but-2-en-2-yl]oxetan-3-yl]methyl]-4-methyl-1,2,4-triazole |
| SMILES | C/C=C(\C)C1(Cc2nncn2C)COC1 |
| InChI | InChI=1S/C11H17N3O/c1-4-9(2)11(6-15-7-11)5-10-13-12-8-14(10)3/h4,8H,5-7H2,1-3H3/b9-4+ |
| InChIKey | QHWPXSBZEJNIIA-RUDMXATFSA-N |
| XLogP | 1.34 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.28 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|