C11H21F2N — CID 169181314
4-(difluoromethylidene)-2,2-diethylpyrrolidine;ethane (PubChem CID 169181314) has the molecular formula C11H21F2N and a molecular weight of 205.29 g/mol. Its IUPAC name is 4-(difluoromethylidene)-2,2-diethylpyrrolidine;ethane.
| Compound Name | 4-(difluoromethylidene)-2,2-diethylpyrrolidine;ethane |
|---|---|
| PubChem CID | 169181314 |
| Molecular Formula | C11H21F2N |
| Molecular Weight | 205.29 g/mol |
| Exact Mass | 205.16 |
| IUPAC Name | 4-(difluoromethylidene)-2,2-diethylpyrrolidine;ethane |
| SMILES | CC.CCC1(CC)CC(=C(F)F)CN1 |
| InChI | InChI=1S/C9H15F2N.C2H6/c1-3-9(4-2)5-7(6-12-9)8(10)11;1-2/h12H,3-6H2,1-2H3;1-2H3 |
| InChIKey | QZRICVUZXAFGCO-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.29 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |