About 4-(difluoromethylidene)-2,2-diethylpyrrolidine;ethane
4-(difluoromethylidene)-2,2-diethylpyrrolidine;ethane (PubChem CID 169181314) has the molecular formula C11H21F2N
and a molecular weight of 205.29 g/mol. Its IUPAC name is 4-(difluoromethylidene)-2,2-diethylpyrrolidine;ethane.
Molecular Properties
| Compound Name | 4-(difluoromethylidene)-2,2-diethylpyrrolidine;ethane |
| PubChem CID | 169181314 |
| Molecular Formula | C11H21F2N |
| Molecular Weight | 205.29 g/mol |
| Exact Mass | 205.16 |
| IUPAC Name | 4-(difluoromethylidene)-2,2-diethylpyrrolidine;ethane |
| SMILES | CC.CCC1(CC)CC(=C(F)F)CN1 |
| InChI | InChI=1S/C9H15F2N.C2H6/c1-3-9(4-2)5-7(6-12-9)8(10)11;1-2/h12H,3-6H2,1-2H3;1-2H3 |
| InChIKey | QZRICVUZXAFGCO-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.29 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-(difluoromethylidene)-2,2-diethylpyrrolidine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(difluoromethylidene)-2,2-diethylpyrrolidine;ethane?
The IUPAC name of 4-(difluoromethylidene)-2,2-diethylpyrrolidine;ethane (CID 169181314) is 4-(difluoromethylidene)-2,2-diethylpyrrolidine;ethane.
What is the SMILES notation for 4-(difluoromethylidene)-2,2-diethylpyrrolidine;ethane?
The canonical SMILES for 4-(difluoromethylidene)-2,2-diethylpyrrolidine;ethane is CC.CCC1(CC)CC(=C(F)F)CN1.
What is the InChIKey of 4-(difluoromethylidene)-2,2-diethylpyrrolidine;ethane?
The InChIKey is QZRICVUZXAFGCO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15F2N.C2H6/c1-3-9(4-2)5-7(6-12-9)8(10)11;1-2/h12H,3-6H2,1-2H3;1-2H3.
What are the key properties of 4-(difluoromethylidene)-2,2-diethylpyrrolidine;ethane?
4-(difluoromethylidene)-2,2-diethylpyrrolidine;ethane has a molecular weight of 205.29 g/mol, XLogP of 3.72, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(difluoromethylidene)-2,2-diethylpyrrolidine;ethane is sourced from PubChem (CID 169181314), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).