C9H11N3S2 — CID 169182632
2-amino-4-sulfanyl-5,6,7,8-tetrahydrothieno[3,2-b]azepine-3-carbonitrile (PubChem CID 169182632) has the molecular formula C9H11N3S2 and a molecular weight of 225.34 g/mol. Its IUPAC name is 2-amino-4-sulfanyl-5,6,7,8-tetrahydrothieno[3,2-b]azepine-3-carbonitrile.
| Compound Name | 2-amino-4-sulfanyl-5,6,7,8-tetrahydrothieno[3,2-b]azepine-3-carbonitrile |
|---|---|
| PubChem CID | 169182632 |
| Molecular Formula | C9H11N3S2 |
| Molecular Weight | 225.34 g/mol |
| Exact Mass | 225.04 |
| IUPAC Name | 2-amino-4-sulfanyl-5,6,7,8-tetrahydrothieno[3,2-b]azepine-3-carbonitrile |
| SMILES | N#Cc1c(N)sc2c1N(S)CCCC2 |
| InChI | InChI=1S/C9H11N3S2/c10-5-6-8-7(14-9(6)11)3-1-2-4-12(8)13/h13H,1-4,11H2 |
| InChIKey | JNQJUZDJDXIPEW-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 53.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.34 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|