C29H28N2O2S — CID 169183032
N-methyl-2-phenylsulfanylaniline;1-(naphthalene-1-carbonyl)pyrrolidine-2-carbaldehyde (PubChem CID 169183032) has the molecular formula C29H28N2O2S and a molecular weight of 468.62 g/mol. Its IUPAC name is N-methyl-2-phenylsulfanylaniline;1-(naphthalene-1-carbonyl)pyrrolidine-2-carbaldehyde.
| Compound Name | N-methyl-2-phenylsulfanylaniline;1-(naphthalene-1-carbonyl)pyrrolidine-2-carbaldehyde |
|---|---|
| PubChem CID | 169183032 |
| Molecular Formula | C29H28N2O2S |
| Molecular Weight | 468.62 g/mol |
| Exact Mass | 468.19 |
| IUPAC Name | N-methyl-2-phenylsulfanylaniline;1-(naphthalene-1-carbonyl)pyrrolidine-2-carbaldehyde |
| SMILES | CNc1ccccc1Sc1ccccc1.O=CC1CCCN1C(=O)c1cccc2ccccc12 |
| InChI | InChI=1S/C16H15NO2.C13H13NS/c18-11-13-7-4-10-17(13)16(19)15-9-3-6-12-5-1-2-8-14(12)15;1-14-12-9-5-6-10-13(12)15-11-7-3-2-4-8-11/h1-3,5-6,8-9,11,13H,4,7,10H2;2-10,14H,1H3 |
| InChIKey | FAPUBLQIQCVFBM-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.62 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|