C20H19ClN2O2 — CID 16918871
(Z)-N-[[1-(4-chlorophenyl)-5-oxopyrrolidin-3-yl]methyl]-3-phenylprop-2-enamide (PubChem CID 16918871) has the molecular formula C20H19ClN2O2 and a molecular weight of 354.84 g/mol. Its IUPAC name is (Z)-N-[[1-(4-chlorophenyl)-5-oxopyrrolidin-3-yl]methyl]-3-phenylprop-2-enamide.
| Compound Name | (Z)-N-[[1-(4-chlorophenyl)-5-oxopyrrolidin-3-yl]methyl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 16918871 |
| Molecular Formula | C20H19ClN2O2 |
| Molecular Weight | 354.84 g/mol |
| Exact Mass | 354.11 |
| IUPAC Name | (Z)-N-[[1-(4-chlorophenyl)-5-oxopyrrolidin-3-yl]methyl]-3-phenylprop-2-enamide |
| SMILES | O=C(/C=C\c1ccccc1)NCC1CC(=O)N(c2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C20H19ClN2O2/c21-17-7-9-18(10-8-17)23-14-16(12-20(23)25)13-22-19(24)11-6-15-4-2-1-3-5-15/h1-11,16H,12-14H2,(H,22,24)/b11-6- |
| InChIKey | ITKHLPSUNKVDOP-WDZFZDKYSA-N |
| XLogP | 3.52 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.84 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|