C21H13Cl3F2O4 — CID 169189036
2-[3,5-dichloro-4-[[3-(3-chloro-4,5-difluorophenyl)-4-hydroxyphenyl]methyl]phenoxy]acetic acid (PubChem CID 169189036) has the molecular formula C21H13Cl3F2O4 and a molecular weight of 473.69 g/mol. Its IUPAC name is 2-[3,5-dichloro-4-[[3-(3-chloro-4,5-difluorophenyl)-4-hydroxyphenyl]methyl]phenoxy]acetic acid.
| Compound Name | 2-[3,5-dichloro-4-[[3-(3-chloro-4,5-difluorophenyl)-4-hydroxyphenyl]methyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 169189036 |
| Molecular Formula | C21H13Cl3F2O4 |
| Molecular Weight | 473.69 g/mol |
| Exact Mass | 471.98 |
| IUPAC Name | 2-[3,5-dichloro-4-[[3-(3-chloro-4,5-difluorophenyl)-4-hydroxyphenyl]methyl]phenoxy]acetic acid |
| SMILES | O=C(O)COc1cc(Cl)c(Cc2ccc(O)c(-c3cc(F)c(F)c(Cl)c3)c2)c(Cl)c1 |
| InChI | InChI=1S/C21H13Cl3F2O4/c22-15-7-12(30-9-20(28)29)8-16(23)14(15)4-10-1-2-19(27)13(3-10)11-5-17(24)21(26)18(25)6-11/h1-3,5-8,27H,4,9H2,(H,28,29) |
| InChIKey | FNHMCJTUGBGTKD-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.69 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|