C29H33Cl4FeN3 — CID 169189413
N-(2-chloro-3,4,5,6-tetramethylphenyl)-1-[6-[N-(2-chloro-3,4,5,6-tetramethylphenyl)-C-methylcarbonimidoyl]-2-pyridinyl]ethanimine;dichloroiron (PubChem CID 169189413) has the molecular formula C29H33Cl4FeN3 and a molecular weight of 621.26 g/mol. Its IUPAC name is N-(2-chloro-3,4,5,6-tetramethylphenyl)-1-[6-[N-(2-chloro-3,4,5,6-tetramethylphenyl)-C-methylcarbonimidoyl]-2-pyridinyl]ethanimine;dichloroiron.
| Compound Name | N-(2-chloro-3,4,5,6-tetramethylphenyl)-1-[6-[N-(2-chloro-3,4,5,6-tetramethylphenyl)-C-methylcarbonimidoyl]-2-pyridinyl]ethanimine;dichloroiron |
|---|---|
| PubChem CID | 169189413 |
| Molecular Formula | C29H33Cl4FeN3 |
| Molecular Weight | 621.26 g/mol |
| Exact Mass | 619.08 |
| IUPAC Name | N-(2-chloro-3,4,5,6-tetramethylphenyl)-1-[6-[N-(2-chloro-3,4,5,6-tetramethylphenyl)-C-methylcarbonimidoyl]-2-pyridinyl]ethanimine;dichloroiron |
| SMILES | C/C(=N\c1c(C)c(C)c(C)c(C)c1Cl)c1cccc(/C(C)=N/c2c(C)c(C)c(C)c(C)c2Cl)n1.Cl[Fe]Cl |
| InChI | InChI=1S/C29H33Cl2N3.2ClH.Fe/c1-14-16(3)20(7)28(26(30)18(14)5)32-22(9)24-12-11-13-25(34-24)23(10)33-29-21(8)17(4)15(2)19(6)27(29)31;;;/h11-13H,1-10H3;2*1H;/q;;;+2/p-2/b32-22+,33-23+;;; |
| InChIKey | KCDSOFIXHQZPPB-YBWNPHJNSA-L |
| XLogP | 10.51 |
| TPSA | 37.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.26 |
| LogP ≤ 5 | 10.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|