C14H18BF3O4 — CID 169189984
2-[2-hydroperoxy-6-methyl-4-(trifluoromethyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 169189984) has the molecular formula C14H18BF3O4 and a molecular weight of 318.10 g/mol. Its IUPAC name is 2-[2-hydroperoxy-6-methyl-4-(trifluoromethyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[2-hydroperoxy-6-methyl-4-(trifluoromethyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 169189984 |
| Molecular Formula | C14H18BF3O4 |
| Molecular Weight | 318.10 g/mol |
| Exact Mass | 318.13 |
| IUPAC Name | 2-[2-hydroperoxy-6-methyl-4-(trifluoromethyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | Cc1cc(C(F)(F)F)cc(OO)c1B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C14H18BF3O4/c1-8-6-9(14(16,17)18)7-10(20-19)11(8)15-21-12(2,3)13(4,5)22-15/h6-7,19H,1-5H3 |
| InChIKey | SQJNIVDUWQTEBN-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.10 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|