C31H43F3N6O2 — CID 169190200
ethane;N-methoxy-N-methyl-5-[4-[1-methyl-4-[[2-methyl-3-(trifluoromethyl)phenyl]methylamino]phthalazin-6-yl]piperazin-1-yl]pentanamide (PubChem CID 169190200) has the molecular formula C31H43F3N6O2 and a molecular weight of 588.72 g/mol. Its IUPAC name is ethane;N-methoxy-N-methyl-5-[4-[1-methyl-4-[[2-methyl-3-(trifluoromethyl)phenyl]methylamino]phthalazin-6-yl]piperazin-1-yl]pentanamide.
| Compound Name | ethane;N-methoxy-N-methyl-5-[4-[1-methyl-4-[[2-methyl-3-(trifluoromethyl)phenyl]methylamino]phthalazin-6-yl]piperazin-1-yl]pentanamide |
|---|---|
| PubChem CID | 169190200 |
| Molecular Formula | C31H43F3N6O2 |
| Molecular Weight | 588.72 g/mol |
| Exact Mass | 588.34 |
| IUPAC Name | ethane;N-methoxy-N-methyl-5-[4-[1-methyl-4-[[2-methyl-3-(trifluoromethyl)phenyl]methylamino]phthalazin-6-yl]piperazin-1-yl]pentanamide |
| SMILES | CC.CON(C)C(=O)CCCCN1CCN(c2ccc3c(C)nnc(NCc4cccc(C(F)(F)F)c4C)c3c2)CC1 |
| InChI | InChI=1S/C29H37F3N6O2.C2H6/c1-20-22(8-7-9-26(20)29(30,31)32)19-33-28-25-18-23(11-12-24(25)21(2)34-35-28)38-16-14-37(15-17-38)13-6-5-10-27(39)36(3)40-4;1-2/h7-9,11-12,18H,5-6,10,13-17,19H2,1-4H3,(H,33,35);1-2H3 |
| InChIKey | GXPGZYMROKJIBD-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 73.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.72 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|