C23H29N5OS — CID 169196854
3-[2-(dimethylamino)ethyl]-1-[(6,7-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-1-(pyridin-2-ylmethyl)thiourea (PubChem CID 169196854) has the molecular formula C23H29N5OS and a molecular weight of 423.59 g/mol. Its IUPAC name is 3-[2-(dimethylamino)ethyl]-1-[(6,7-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-1-(pyridin-2-ylmethyl)thiourea.
| Compound Name | 3-[2-(dimethylamino)ethyl]-1-[(6,7-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-1-(pyridin-2-ylmethyl)thiourea |
|---|---|
| PubChem CID | 169196854 |
| Molecular Formula | C23H29N5OS |
| Molecular Weight | 423.59 g/mol |
| Exact Mass | 423.21 |
| IUPAC Name | 3-[2-(dimethylamino)ethyl]-1-[(6,7-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-1-(pyridin-2-ylmethyl)thiourea |
| SMILES | Cc1cc2cc(CN(Cc3ccccn3)C(=S)NCCN(C)C)c(=O)[nH]c2cc1C |
| InChI | InChI=1S/C23H29N5OS/c1-16-11-18-13-19(22(29)26-21(18)12-17(16)2)14-28(15-20-7-5-6-8-24-20)23(30)25-9-10-27(3)4/h5-8,11-13H,9-10,14-15H2,1-4H3,(H,25,30)(H,26,29) |
| InChIKey | FWZXAFJGCWLOCP-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 64.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.59 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|