C31H40FN5O4S — CID 169197569
N-[(1R)-1-(4-carbamimidoyl-2,3-dihydrothiophen-2-yl)ethyl]-5-ethyl-1-[2-[[4-(4-fluorophenoxy)benzoyl]amino]acetyl]pyrrolidine-2-carboxamide;ethane (PubChem CID 169197569) has the molecular formula C31H40FN5O4S and a molecular weight of 597.76 g/mol. Its IUPAC name is N-[(1R)-1-(4-carbamimidoyl-2,3-dihydrothiophen-2-yl)ethyl]-5-ethyl-1-[2-[[4-(4-fluorophenoxy)benzoyl]amino]acetyl]pyrrolidine-2-carboxamide;ethane.
| Compound Name | N-[(1R)-1-(4-carbamimidoyl-2,3-dihydrothiophen-2-yl)ethyl]-5-ethyl-1-[2-[[4-(4-fluorophenoxy)benzoyl]amino]acetyl]pyrrolidine-2-carboxamide;ethane |
|---|---|
| PubChem CID | 169197569 |
| Molecular Formula | C31H40FN5O4S |
| Molecular Weight | 597.76 g/mol |
| Exact Mass | 597.28 |
| IUPAC Name | N-[(1R)-1-(4-carbamimidoyl-2,3-dihydrothiophen-2-yl)ethyl]-5-ethyl-1-[2-[[4-(4-fluorophenoxy)benzoyl]amino]acetyl]pyrrolidine-2-carboxamide;ethane |
| SMILES | CC.[H]/N=C(\N)C1=CSC([C@@H](C)NC(=O)C2CCC(CC)N2C(=O)CNC(=O)c2ccc(Oc3ccc(F)cc3)cc2)C1 |
| InChI | InChI=1S/C29H34FN5O4S.C2H6/c1-3-21-8-13-24(29(38)34-17(2)25-14-19(16-40-25)27(31)32)35(21)26(36)15-33-28(37)18-4-9-22(10-5-18)39-23-11-6-20(30)7-12-23;1-2/h4-7,9-12,16-17,21,24-25H,3,8,13-15H2,1-2H3,(H3,31,32)(H,33,37)(H,34,38);1-2H3/t17-,21?,24?,25?;/m1./s1 |
| InChIKey | HCFQWXQBNYMZQY-GSHAAABDSA-N |
| XLogP | 4.97 |
| TPSA | 137.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.76 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|