C13H19N3OS2 — CID 169199174
(R)-N-[(1R)-1-[4-(1H-imidazol-5-yl)thiophen-2-yl]ethyl]-2-methylpropane-2-sulfinamide (PubChem CID 169199174) has the molecular formula C13H19N3OS2 and a molecular weight of 297.45 g/mol. Its IUPAC name is (R)-N-[(1R)-1-[4-(1H-imidazol-5-yl)thiophen-2-yl]ethyl]-2-methylpropane-2-sulfinamide.
| Compound Name | (R)-N-[(1R)-1-[4-(1H-imidazol-5-yl)thiophen-2-yl]ethyl]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 169199174 |
| Molecular Formula | C13H19N3OS2 |
| Molecular Weight | 297.45 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | (R)-N-[(1R)-1-[4-(1H-imidazol-5-yl)thiophen-2-yl]ethyl]-2-methylpropane-2-sulfinamide |
| SMILES | C[C@@H](N[S@](=O)C(C)(C)C)c1cc(-c2cnc[nH]2)cs1 |
| InChI | InChI=1S/C13H19N3OS2/c1-9(16-19(17)13(2,3)4)12-5-10(7-18-12)11-6-14-8-15-11/h5-9,16H,1-4H3,(H,14,15)/t9-,19-/m1/s1 |
| InChIKey | BDVSGONQDNRUSJ-AYLIAGHASA-N |
| XLogP | 3.25 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.45 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |