C19H17F3N2O3 — CID 169199864
2-[[8-[4-(trifluoromethyl)cyclohexen-1-yl]quinoline-3-carbonyl]amino]acetic acid (PubChem CID 169199864) has the molecular formula C19H17F3N2O3 and a molecular weight of 378.35 g/mol. Its IUPAC name is 2-[[8-[4-(trifluoromethyl)cyclohexen-1-yl]quinoline-3-carbonyl]amino]acetic acid.
| Compound Name | 2-[[8-[4-(trifluoromethyl)cyclohexen-1-yl]quinoline-3-carbonyl]amino]acetic acid |
|---|---|
| PubChem CID | 169199864 |
| Molecular Formula | C19H17F3N2O3 |
| Molecular Weight | 378.35 g/mol |
| Exact Mass | 378.12 |
| IUPAC Name | 2-[[8-[4-(trifluoromethyl)cyclohexen-1-yl]quinoline-3-carbonyl]amino]acetic acid |
| SMILES | O=C(O)CNC(=O)c1cnc2c(C3=CCC(C(F)(F)F)CC3)cccc2c1 |
| InChI | InChI=1S/C19H17F3N2O3/c20-19(21,22)14-6-4-11(5-7-14)15-3-1-2-12-8-13(9-23-17(12)15)18(27)24-10-16(25)26/h1-4,8-9,14H,5-7,10H2,(H,24,27)(H,25,26) |
| InChIKey | NUUXEDWURUDZOT-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.35 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |