C20H21F3N2O2 — CID 170162645
N-(3-hydroxypropyl)-8-[(4S)-4-(trifluoromethyl)cyclohexen-1-yl]quinoline-3-carboxamide (PubChem CID 170162645) has the molecular formula C20H21F3N2O2 and a molecular weight of 378.39 g/mol. Its IUPAC name is N-(3-hydroxypropyl)-8-[(4S)-4-(trifluoromethyl)cyclohexen-1-yl]quinoline-3-carboxamide.
| Compound Name | N-(3-hydroxypropyl)-8-[(4S)-4-(trifluoromethyl)cyclohexen-1-yl]quinoline-3-carboxamide |
|---|---|
| PubChem CID | 170162645 |
| Molecular Formula | C20H21F3N2O2 |
| Molecular Weight | 378.39 g/mol |
| Exact Mass | 378.16 |
| IUPAC Name | N-(3-hydroxypropyl)-8-[(4S)-4-(trifluoromethyl)cyclohexen-1-yl]quinoline-3-carboxamide |
| SMILES | O=C(NCCCO)c1cnc2c(C3=CC[C@@H](C(F)(F)F)CC3)cccc2c1 |
| InChI | InChI=1S/C20H21F3N2O2/c21-20(22,23)16-7-5-13(6-8-16)17-4-1-3-14-11-15(12-25-18(14)17)19(27)24-9-2-10-26/h1,3-5,11-12,16,26H,2,6-10H2,(H,24,27)/t16-/m1/s1 |
| InChIKey | UGTYSLVJVOHLHG-MRXNPFEDSA-N |
| XLogP | 4.09 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.39 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|