C24H28F3N3O3 — CID 169199613
tert-butyl N-[2-[[8-[4-(trifluoromethyl)cyclohexen-1-yl]quinoline-3-carbonyl]amino]ethyl]carbamate (PubChem CID 169199613) has the molecular formula C24H28F3N3O3 and a molecular weight of 463.50 g/mol. Its IUPAC name is tert-butyl N-[2-[[8-[4-(trifluoromethyl)cyclohexen-1-yl]quinoline-3-carbonyl]amino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[8-[4-(trifluoromethyl)cyclohexen-1-yl]quinoline-3-carbonyl]amino]ethyl]carbamate |
|---|---|
| PubChem CID | 169199613 |
| Molecular Formula | C24H28F3N3O3 |
| Molecular Weight | 463.50 g/mol |
| Exact Mass | 463.21 |
| IUPAC Name | tert-butyl N-[2-[[8-[4-(trifluoromethyl)cyclohexen-1-yl]quinoline-3-carbonyl]amino]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCNC(=O)c1cnc2c(C3=CCC(C(F)(F)F)CC3)cccc2c1 |
| InChI | InChI=1S/C24H28F3N3O3/c1-23(2,3)33-22(32)29-12-11-28-21(31)17-13-16-5-4-6-19(20(16)30-14-17)15-7-9-18(10-8-15)24(25,26)27/h4-7,13-14,18H,8-12H2,1-3H3,(H,28,31)(H,29,32) |
| InChIKey | NKTXKLNTSAITCZ-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.50 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|