C22H31N3O3S — CID 145262810
tert-butyl N-[3-[(8-tert-butylsulfanylquinoline-3-carbonyl)amino]propyl]carbamate (PubChem CID 145262810) has the molecular formula C22H31N3O3S and a molecular weight of 417.58 g/mol. Its IUPAC name is tert-butyl N-[3-[(8-tert-butylsulfanylquinoline-3-carbonyl)amino]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[(8-tert-butylsulfanylquinoline-3-carbonyl)amino]propyl]carbamate |
|---|---|
| PubChem CID | 145262810 |
| Molecular Formula | C22H31N3O3S |
| Molecular Weight | 417.58 g/mol |
| Exact Mass | 417.21 |
| IUPAC Name | tert-butyl N-[3-[(8-tert-butylsulfanylquinoline-3-carbonyl)amino]propyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCNC(=O)c1cnc2c(SC(C)(C)C)cccc2c1 |
| InChI | InChI=1S/C22H31N3O3S/c1-21(2,3)28-20(27)24-12-8-11-23-19(26)16-13-15-9-7-10-17(18(15)25-14-16)29-22(4,5)6/h7,9-10,13-14H,8,11-12H2,1-6H3,(H,23,26)(H,24,27) |
| InChIKey | PAMLAQLBKOQQHG-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.58 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|