C19H18N2OS — CID 160735019
N-(3-phenylpropyl)-8-sulfanylquinoline-3-carboxamide (PubChem CID 160735019) has the molecular formula C19H18N2OS and a molecular weight of 322.43 g/mol. Its IUPAC name is N-(3-phenylpropyl)-8-sulfanylquinoline-3-carboxamide.
| Compound Name | N-(3-phenylpropyl)-8-sulfanylquinoline-3-carboxamide |
|---|---|
| PubChem CID | 160735019 |
| Molecular Formula | C19H18N2OS |
| Molecular Weight | 322.43 g/mol |
| Exact Mass | 322.11 |
| IUPAC Name | N-(3-phenylpropyl)-8-sulfanylquinoline-3-carboxamide |
| SMILES | O=C(NCCCc1ccccc1)c1cnc2c(S)cccc2c1 |
| InChI | InChI=1S/C19H18N2OS/c22-19(20-11-5-8-14-6-2-1-3-7-14)16-12-15-9-4-10-17(23)18(15)21-13-16/h1-4,6-7,9-10,12-13,23H,5,8,11H2,(H,20,22) |
| InChIKey | RUVJAXLJOILHFM-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.43 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|