C14H14N2O2 — CID 169203032
5-(7-methoxyindolizin-1-yl)-2,4-dimethyl-1,3-oxazole (PubChem CID 169203032) has the molecular formula C14H14N2O2 and a molecular weight of 242.28 g/mol. Its IUPAC name is 5-(7-methoxyindolizin-1-yl)-2,4-dimethyl-1,3-oxazole.
| Compound Name | 5-(7-methoxyindolizin-1-yl)-2,4-dimethyl-1,3-oxazole |
|---|---|
| PubChem CID | 169203032 |
| Molecular Formula | C14H14N2O2 |
| Molecular Weight | 242.28 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | 5-(7-methoxyindolizin-1-yl)-2,4-dimethyl-1,3-oxazole |
| SMILES | COc1ccn2ccc(-c3oc(C)nc3C)c2c1 |
| InChI | InChI=1S/C14H14N2O2/c1-9-14(18-10(2)15-9)12-5-7-16-6-4-11(17-3)8-13(12)16/h4-8H,1-3H3 |
| InChIKey | YDWGRUIYUZBALE-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 39.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.28 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |