C22H31F2N3O3 — CID 169204917
1-[4-[C-[1-[4-(difluoromethoxy)phenoxy]ethyl]-N-[(Z)-prop-1-enyl]carbonimidoyl]piperazin-1-yl]prop-2-en-1-one;ethane (PubChem CID 169204917) has the molecular formula C22H31F2N3O3 and a molecular weight of 423.50 g/mol. Its IUPAC name is 1-[4-[C-[1-[4-(difluoromethoxy)phenoxy]ethyl]-N-[(Z)-prop-1-enyl]carbonimidoyl]piperazin-1-yl]prop-2-en-1-one;ethane.
| Compound Name | 1-[4-[C-[1-[4-(difluoromethoxy)phenoxy]ethyl]-N-[(Z)-prop-1-enyl]carbonimidoyl]piperazin-1-yl]prop-2-en-1-one;ethane |
|---|---|
| PubChem CID | 169204917 |
| Molecular Formula | C22H31F2N3O3 |
| Molecular Weight | 423.50 g/mol |
| Exact Mass | 423.23 |
| IUPAC Name | 1-[4-[C-[1-[4-(difluoromethoxy)phenoxy]ethyl]-N-[(Z)-prop-1-enyl]carbonimidoyl]piperazin-1-yl]prop-2-en-1-one;ethane |
| SMILES | C=CC(=O)N1CCN(/C(=N/C=C\C)C(C)Oc2ccc(OC(F)F)cc2)CC1.CC |
| InChI | InChI=1S/C20H25F2N3O3.C2H6/c1-4-10-23-19(25-13-11-24(12-14-25)18(26)5-2)15(3)27-16-6-8-17(9-7-16)28-20(21)22;1-2/h4-10,15,20H,2,11-14H2,1,3H3;1-2H3/b10-4-,23-19+; |
| InChIKey | MAMVDDQSWXUYHI-STGDWLQRSA-N |
| XLogP | 4.34 |
| TPSA | 54.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.50 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|