C21H26F2N4O2 — CID 169205190
1-[4-[C-[1-[[6-(1,1-difluoropropyl)-3-pyridinyl]oxy]ethenyl]-N-[(Z)-prop-1-enyl]carbonimidoyl]piperazin-1-yl]prop-2-en-1-one (PubChem CID 169205190) has the molecular formula C21H26F2N4O2 and a molecular weight of 404.46 g/mol. Its IUPAC name is 1-[4-[C-[1-[[6-(1,1-difluoropropyl)-3-pyridinyl]oxy]ethenyl]-N-[(Z)-prop-1-enyl]carbonimidoyl]piperazin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[4-[C-[1-[[6-(1,1-difluoropropyl)-3-pyridinyl]oxy]ethenyl]-N-[(Z)-prop-1-enyl]carbonimidoyl]piperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 169205190 |
| Molecular Formula | C21H26F2N4O2 |
| Molecular Weight | 404.46 g/mol |
| Exact Mass | 404.20 |
| IUPAC Name | 1-[4-[C-[1-[[6-(1,1-difluoropropyl)-3-pyridinyl]oxy]ethenyl]-N-[(Z)-prop-1-enyl]carbonimidoyl]piperazin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCN(/C(=N/C=C\C)C(=C)Oc2ccc(C(F)(F)CC)nc2)CC1 |
| InChI | InChI=1S/C21H26F2N4O2/c1-5-10-24-20(27-13-11-26(12-14-27)19(28)6-2)16(4)29-17-8-9-18(25-15-17)21(22,23)7-3/h5-6,8-10,15H,2,4,7,11-14H2,1,3H3/b10-5-,24-20+ |
| InChIKey | AAFNTWTWWJLYCE-VLLUOLHESA-N |
| XLogP | 3.74 |
| TPSA | 58.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.46 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|