C20H28F2N6O — CID 169205112
1-[4-[C-[1-[[2-(1,1-difluoropropyl)pyrimidin-5-yl]amino]ethenyl]-N-[(Z)-prop-1-enyl]carbonimidoyl]piperazin-1-yl]prop-2-en-1-one;molecular hydrogen (PubChem CID 169205112) has the molecular formula C20H28F2N6O and a molecular weight of 406.48 g/mol. Its IUPAC name is 1-[4-[C-[1-[[2-(1,1-difluoropropyl)pyrimidin-5-yl]amino]ethenyl]-N-[(Z)-prop-1-enyl]carbonimidoyl]piperazin-1-yl]prop-2-en-1-one;molecular hydrogen.
| Compound Name | 1-[4-[C-[1-[[2-(1,1-difluoropropyl)pyrimidin-5-yl]amino]ethenyl]-N-[(Z)-prop-1-enyl]carbonimidoyl]piperazin-1-yl]prop-2-en-1-one;molecular hydrogen |
|---|---|
| PubChem CID | 169205112 |
| Molecular Formula | C20H28F2N6O |
| Molecular Weight | 406.48 g/mol |
| Exact Mass | 406.23 |
| IUPAC Name | 1-[4-[C-[1-[[2-(1,1-difluoropropyl)pyrimidin-5-yl]amino]ethenyl]-N-[(Z)-prop-1-enyl]carbonimidoyl]piperazin-1-yl]prop-2-en-1-one;molecular hydrogen |
| SMILES | C=CC(=O)N1CCN(/C(=N\C=C/C)C(=C)Nc2cnc(C(F)(F)CC)nc2)CC1.[H][H] |
| InChI | InChI=1S/C20H26F2N6O.H2/c1-5-8-23-18(28-11-9-27(10-12-28)17(29)6-2)15(4)26-16-13-24-19(25-14-16)20(21,22)7-3;/h5-6,8,13-14,26H,2,4,7,9-12H2,1,3H3;1H/b8-5-,23-18-; |
| InChIKey | GUIJMIANYIDKTI-CMBXDGTOSA-N |
| XLogP | 3.41 |
| TPSA | 73.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.48 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|