C20H24ClF3N4O — CID 169205204
2-chloro-1-[4-[C-[1-[4-(1,1-difluoroethyl)anilino]ethenyl]-N-[(Z)-prop-1-enyl]carbonimidoyl]piperazin-1-yl]-2-fluoroethanone (PubChem CID 169205204) has the molecular formula C20H24ClF3N4O and a molecular weight of 428.89 g/mol. Its IUPAC name is 2-chloro-1-[4-[C-[1-[4-(1,1-difluoroethyl)anilino]ethenyl]-N-[(Z)-prop-1-enyl]carbonimidoyl]piperazin-1-yl]-2-fluoroethanone.
| Compound Name | 2-chloro-1-[4-[C-[1-[4-(1,1-difluoroethyl)anilino]ethenyl]-N-[(Z)-prop-1-enyl]carbonimidoyl]piperazin-1-yl]-2-fluoroethanone |
|---|---|
| PubChem CID | 169205204 |
| Molecular Formula | C20H24ClF3N4O |
| Molecular Weight | 428.89 g/mol |
| Exact Mass | 428.16 |
| IUPAC Name | 2-chloro-1-[4-[C-[1-[4-(1,1-difluoroethyl)anilino]ethenyl]-N-[(Z)-prop-1-enyl]carbonimidoyl]piperazin-1-yl]-2-fluoroethanone |
| SMILES | C=C(Nc1ccc(C(C)(F)F)cc1)/C(=N\C=C/C)N1CCN(C(=O)C(F)Cl)CC1 |
| InChI | InChI=1S/C20H24ClF3N4O/c1-4-9-25-18(27-10-12-28(13-11-27)19(29)17(21)22)14(2)26-16-7-5-15(6-8-16)20(3,23)24/h4-9,17,26H,2,10-13H2,1,3H3/b9-4-,25-18+ |
| InChIKey | XLTHPERRFYHZNP-GVOCMCMPSA-N |
| XLogP | 4.33 |
| TPSA | 47.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.89 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|