C26H25F2N3O2 — CID 169205417
2-(1-ethenylidene-3-oxoisoindol-2-yl)ethyl 2-[4-(1,1-difluoroethyl)anilino]-N-[(Z)-prop-1-enyl]prop-2-enimidate (PubChem CID 169205417) has the molecular formula C26H25F2N3O2 and a molecular weight of 449.50 g/mol. Its IUPAC name is 2-(1-ethenylidene-3-oxoisoindol-2-yl)ethyl 2-[4-(1,1-difluoroethyl)anilino]-N-[(Z)-prop-1-enyl]prop-2-enimidate.
| Compound Name | 2-(1-ethenylidene-3-oxoisoindol-2-yl)ethyl 2-[4-(1,1-difluoroethyl)anilino]-N-[(Z)-prop-1-enyl]prop-2-enimidate |
|---|---|
| PubChem CID | 169205417 |
| Molecular Formula | C26H25F2N3O2 |
| Molecular Weight | 449.50 g/mol |
| Exact Mass | 449.19 |
| IUPAC Name | 2-(1-ethenylidene-3-oxoisoindol-2-yl)ethyl 2-[4-(1,1-difluoroethyl)anilino]-N-[(Z)-prop-1-enyl]prop-2-enimidate |
| SMILES | C=C=C1c2ccccc2C(=O)N1CCO/C(=N/C=C\C)C(=C)Nc1ccc(C(C)(F)F)cc1 |
| InChI | InChI=1S/C26H25F2N3O2/c1-5-15-29-24(18(3)30-20-13-11-19(12-14-20)26(4,27)28)33-17-16-31-23(6-2)21-9-7-8-10-22(21)25(31)32/h5,7-15,30H,2-3,16-17H2,1,4H3/b15-5-,29-24+ |
| InChIKey | XJTMAAFQGQCOFQ-HDRNFQNTSA-N |
| XLogP | 5.95 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.50 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|