C24H31F2N5O — CID 169205017
(E)-4-[4-[C-[1-[4-(1,1-difluoroethyl)anilino]ethenyl]-N-[(Z)-prop-1-enyl]carbonimidoyl]piperazin-1-yl]-4-oxobut-2-enenitrile;ethane (PubChem CID 169205017) has the molecular formula C24H31F2N5O and a molecular weight of 443.54 g/mol. Its IUPAC name is (E)-4-[4-[C-[1-[4-(1,1-difluoroethyl)anilino]ethenyl]-N-[(Z)-prop-1-enyl]carbonimidoyl]piperazin-1-yl]-4-oxobut-2-enenitrile;ethane.
| Compound Name | (E)-4-[4-[C-[1-[4-(1,1-difluoroethyl)anilino]ethenyl]-N-[(Z)-prop-1-enyl]carbonimidoyl]piperazin-1-yl]-4-oxobut-2-enenitrile;ethane |
|---|---|
| PubChem CID | 169205017 |
| Molecular Formula | C24H31F2N5O |
| Molecular Weight | 443.54 g/mol |
| Exact Mass | 443.25 |
| IUPAC Name | (E)-4-[4-[C-[1-[4-(1,1-difluoroethyl)anilino]ethenyl]-N-[(Z)-prop-1-enyl]carbonimidoyl]piperazin-1-yl]-4-oxobut-2-enenitrile;ethane |
| SMILES | C=C(Nc1ccc(C(C)(F)F)cc1)/C(=N\C=C/C)N1CCN(C(=O)/C=C/C#N)CC1.CC |
| InChI | InChI=1S/C22H25F2N5O.C2H6/c1-4-12-26-21(29-15-13-28(14-16-29)20(30)6-5-11-25)17(2)27-19-9-7-18(8-10-19)22(3,23)24;1-2/h4-10,12,27H,2,13-16H2,1,3H3;1-2H3/b6-5+,12-4-,26-21+; |
| InChIKey | LVJUIYFYTSGQNI-YTOOCORYSA-N |
| XLogP | 4.91 |
| TPSA | 71.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.54 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|