C20H23F3N4O2 — CID 170273996
1-[4-[N-[(Z)-prop-1-enyl]-C-[1-[4-(trifluoromethoxy)anilino]ethenyl]carbonimidoyl]piperazin-1-yl]prop-2-en-1-one (PubChem CID 170273996) has the molecular formula C20H23F3N4O2 and a molecular weight of 408.42 g/mol. Its IUPAC name is 1-[4-[N-[(Z)-prop-1-enyl]-C-[1-[4-(trifluoromethoxy)anilino]ethenyl]carbonimidoyl]piperazin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[4-[N-[(Z)-prop-1-enyl]-C-[1-[4-(trifluoromethoxy)anilino]ethenyl]carbonimidoyl]piperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 170273996 |
| Molecular Formula | C20H23F3N4O2 |
| Molecular Weight | 408.42 g/mol |
| Exact Mass | 408.18 |
| IUPAC Name | 1-[4-[N-[(Z)-prop-1-enyl]-C-[1-[4-(trifluoromethoxy)anilino]ethenyl]carbonimidoyl]piperazin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCN(/C(=N/C=C\C)C(=C)Nc2ccc(OC(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C20H23F3N4O2/c1-4-10-24-19(27-13-11-26(12-14-27)18(28)5-2)15(3)25-16-6-8-17(9-7-16)29-20(21,22)23/h4-10,25H,2-3,11-14H2,1H3/b10-4-,24-19+ |
| InChIKey | QAQQWEYKUVREBF-ICNXYPBMSA-N |
| XLogP | 3.77 |
| TPSA | 57.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.42 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|