C17H21F3N4O2S — CID 9215439
2-[4-(prop-2-enylcarbamothioyl)piperazin-1-yl]-N-[4-(trifluoromethoxy)phenyl]acetamide (PubChem CID 9215439) has the molecular formula C17H21F3N4O2S and a molecular weight of 402.44 g/mol. Its IUPAC name is 2-[4-(prop-2-enylcarbamothioyl)piperazin-1-yl]-N-[4-(trifluoromethoxy)phenyl]acetamide.
| Compound Name | 2-[4-(prop-2-enylcarbamothioyl)piperazin-1-yl]-N-[4-(trifluoromethoxy)phenyl]acetamide |
|---|---|
| PubChem CID | 9215439 |
| Molecular Formula | C17H21F3N4O2S |
| Molecular Weight | 402.44 g/mol |
| Exact Mass | 402.13 |
| IUPAC Name | 2-[4-(prop-2-enylcarbamothioyl)piperazin-1-yl]-N-[4-(trifluoromethoxy)phenyl]acetamide |
| SMILES | C=CCNC(=S)N1CCN(CC(=O)Nc2ccc(OC(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C17H21F3N4O2S/c1-2-7-21-16(27)24-10-8-23(9-11-24)12-15(25)22-13-3-5-14(6-4-13)26-17(18,19)20/h2-6H,1,7-12H2,(H,21,27)(H,22,25) |
| InChIKey | UKQXQYCNBJYHOE-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.44 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|