C22H27F2N5O — CID 169205397
1-[4-[C-[1-[[5-(1,1-difluoroprop-2-enyl)-2-pyridinyl]-methylamino]ethenyl]-N-[(Z)-prop-1-enyl]carbonimidoyl]piperazin-1-yl]prop-2-en-1-one (PubChem CID 169205397) has the molecular formula C22H27F2N5O and a molecular weight of 415.49 g/mol. Its IUPAC name is 1-[4-[C-[1-[[5-(1,1-difluoroprop-2-enyl)-2-pyridinyl]-methylamino]ethenyl]-N-[(Z)-prop-1-enyl]carbonimidoyl]piperazin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[4-[C-[1-[[5-(1,1-difluoroprop-2-enyl)-2-pyridinyl]-methylamino]ethenyl]-N-[(Z)-prop-1-enyl]carbonimidoyl]piperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 169205397 |
| Molecular Formula | C22H27F2N5O |
| Molecular Weight | 415.49 g/mol |
| Exact Mass | 415.22 |
| IUPAC Name | 1-[4-[C-[1-[[5-(1,1-difluoroprop-2-enyl)-2-pyridinyl]-methylamino]ethenyl]-N-[(Z)-prop-1-enyl]carbonimidoyl]piperazin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCN(/C(=N\C=C/C)C(=C)N(C)c2ccc(C(F)(F)C=C)cn2)CC1 |
| InChI | InChI=1S/C22H27F2N5O/c1-6-11-25-21(29-14-12-28(13-15-29)20(30)7-2)17(4)27(5)19-10-9-18(16-26-19)22(23,24)8-3/h6-11,16H,2-4,12-15H2,1,5H3/b11-6-,25-21- |
| InChIKey | IJVZJRKXVQACLM-MWBNPKDOSA-N |
| XLogP | 3.57 |
| TPSA | 52.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.49 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|