C22H26F2N2O2 — CID 169205161
1-[4-[(3Z,5Z)-2-[[6-(1,1-difluoroethyl)-3-pyridinyl]oxy]hepta-1,3,5-trien-3-yl]piperidin-1-yl]prop-2-en-1-one (PubChem CID 169205161) has the molecular formula C22H26F2N2O2 and a molecular weight of 388.46 g/mol. Its IUPAC name is 1-[4-[(3Z,5Z)-2-[[6-(1,1-difluoroethyl)-3-pyridinyl]oxy]hepta-1,3,5-trien-3-yl]piperidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[4-[(3Z,5Z)-2-[[6-(1,1-difluoroethyl)-3-pyridinyl]oxy]hepta-1,3,5-trien-3-yl]piperidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 169205161 |
| Molecular Formula | C22H26F2N2O2 |
| Molecular Weight | 388.46 g/mol |
| Exact Mass | 388.20 |
| IUPAC Name | 1-[4-[(3Z,5Z)-2-[[6-(1,1-difluoroethyl)-3-pyridinyl]oxy]hepta-1,3,5-trien-3-yl]piperidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCC(/C(=C/C=C\C)C(=C)Oc2ccc(C(C)(F)F)nc2)CC1 |
| InChI | InChI=1S/C22H26F2N2O2/c1-5-7-8-19(17-11-13-26(14-12-17)21(27)6-2)16(3)28-18-9-10-20(25-15-18)22(4,23)24/h5-10,15,17H,2-3,11-14H2,1,4H3/b7-5-,19-8+ |
| InChIKey | FDOYWNGYGFGAEX-WWUDHOGVSA-N |
| XLogP | 5.01 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.46 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|