C18H25FN2 — CID 169204948
4-(2-fluoropropan-2-yl)-N-[(2Z,4Z)-3-methyl-1-methyliminohepta-2,4-dien-4-yl]aniline (PubChem CID 169204948) has the molecular formula C18H25FN2 and a molecular weight of 288.41 g/mol. Its IUPAC name is 4-(2-fluoropropan-2-yl)-N-[(2Z,4Z)-3-methyl-1-methyliminohepta-2,4-dien-4-yl]aniline.
| Compound Name | 4-(2-fluoropropan-2-yl)-N-[(2Z,4Z)-3-methyl-1-methyliminohepta-2,4-dien-4-yl]aniline |
|---|---|
| PubChem CID | 169204948 |
| Molecular Formula | C18H25FN2 |
| Molecular Weight | 288.41 g/mol |
| Exact Mass | 288.20 |
| IUPAC Name | 4-(2-fluoropropan-2-yl)-N-[(2Z,4Z)-3-methyl-1-methyliminohepta-2,4-dien-4-yl]aniline |
| SMILES | CC/C=C(Nc1ccc(C(C)(C)F)cc1)/C(C)=C\C=N\C |
| InChI | InChI=1S/C18H25FN2/c1-6-7-17(14(2)12-13-20-5)21-16-10-8-15(9-11-16)18(3,4)19/h7-13,21H,6H2,1-5H3/b14-12-,17-7-,20-13+ |
| InChIKey | IJBNURFXADHYFA-FJEHKDLFSA-N |
| XLogP | 5.24 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.41 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|