C26H39F2N3 — CID 139541284
5-(1,1-difluoroethyl)-2-[dimethylamino(methyl)amino]-N-[(3E,5Z,7E)-5,7-dimethyl-8-(2-methylcyclopropyl)nona-3,5,7-trien-4-yl]aniline (PubChem CID 139541284) has the molecular formula C26H39F2N3 and a molecular weight of 431.62 g/mol. Its IUPAC name is 5-(1,1-difluoroethyl)-2-[dimethylamino(methyl)amino]-N-[(3E,5Z,7E)-5,7-dimethyl-8-(2-methylcyclopropyl)nona-3,5,7-trien-4-yl]aniline.
| Compound Name | 5-(1,1-difluoroethyl)-2-[dimethylamino(methyl)amino]-N-[(3E,5Z,7E)-5,7-dimethyl-8-(2-methylcyclopropyl)nona-3,5,7-trien-4-yl]aniline |
|---|---|
| PubChem CID | 139541284 |
| Molecular Formula | C26H39F2N3 |
| Molecular Weight | 431.62 g/mol |
| Exact Mass | 431.31 |
| IUPAC Name | 5-(1,1-difluoroethyl)-2-[dimethylamino(methyl)amino]-N-[(3E,5Z,7E)-5,7-dimethyl-8-(2-methylcyclopropyl)nona-3,5,7-trien-4-yl]aniline |
| SMILES | CC/C=C(Nc1cc(C(C)(F)F)ccc1N(C)N(C)C)\C(C)=C/C(C)=C(\C)C1CC1C |
| InChI | InChI=1S/C26H39F2N3/c1-10-11-23(19(4)14-17(2)20(5)22-15-18(22)3)29-24-16-21(26(6,27)28)12-13-25(24)31(9)30(7)8/h11-14,16,18,22,29H,10,15H2,1-9H3/b19-14-,20-17+,23-11+ |
| InChIKey | AOCVCOHJVMKKPK-UTNLYCSJSA-N |
| XLogP | 7.36 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.62 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|