C29H29N5O7 — CID 169206107
[3-[6-[8-(2-hydroxyethoxy)-4-(pyrrolidin-1-ylmethyl)-1,5-naphthyridin-2-yl]-3-oxo-1H-isoindol-2-yl]-2,6-dioxopiperidin-1-yl] formate (PubChem CID 169206107) has the molecular formula C29H29N5O7 and a molecular weight of 559.58 g/mol. Its IUPAC name is [3-[6-[8-(2-hydroxyethoxy)-4-(pyrrolidin-1-ylmethyl)-1,5-naphthyridin-2-yl]-3-oxo-1H-isoindol-2-yl]-2,6-dioxopiperidin-1-yl] formate.
| Compound Name | [3-[6-[8-(2-hydroxyethoxy)-4-(pyrrolidin-1-ylmethyl)-1,5-naphthyridin-2-yl]-3-oxo-1H-isoindol-2-yl]-2,6-dioxopiperidin-1-yl] formate |
|---|---|
| PubChem CID | 169206107 |
| Molecular Formula | C29H29N5O7 |
| Molecular Weight | 559.58 g/mol |
| Exact Mass | 559.21 |
| IUPAC Name | [3-[6-[8-(2-hydroxyethoxy)-4-(pyrrolidin-1-ylmethyl)-1,5-naphthyridin-2-yl]-3-oxo-1H-isoindol-2-yl]-2,6-dioxopiperidin-1-yl] formate |
| SMILES | O=CON1C(=O)CCC(N2Cc3cc(-c4cc(CN5CCCC5)c5nccc(OCCO)c5n4)ccc3C2=O)C1=O |
| InChI | InChI=1S/C29H29N5O7/c35-11-12-40-24-7-8-30-26-20(15-32-9-1-2-10-32)14-22(31-27(24)26)18-3-4-21-19(13-18)16-33(28(21)38)23-5-6-25(37)34(29(23)39)41-17-36/h3-4,7-8,13-14,17,23,35H,1-2,5-6,9-12,15-16H2 |
| InChIKey | FTHCRDVTYOBDLP-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 142.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.58 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|